C15H26N2 — CID 22867708
(6S,8aS)-5,5,8a-trimethyl-2-prop-2-enyl-3,6,7,8-tetrahydro-1H-isoquinolin-6-amine (PubChem CID 22867708) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is (6S,8aS)-5,5,8a-trimethyl-2-prop-2-enyl-3,6,7,8-tetrahydro-1H-isoquinolin-6-amine.
| Compound Name | (6S,8aS)-5,5,8a-trimethyl-2-prop-2-enyl-3,6,7,8-tetrahydro-1H-isoquinolin-6-amine |
|---|---|
| PubChem CID | 22867708 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | (6S,8aS)-5,5,8a-trimethyl-2-prop-2-enyl-3,6,7,8-tetrahydro-1H-isoquinolin-6-amine |
| SMILES | C=CCN1CC=C2C(C)(C)[C@@H](N)CC[C@]2(C)C1 |
| InChI | InChI=1S/C15H26N2/c1-5-9-17-10-7-12-14(2,3)13(16)6-8-15(12,4)11-17/h5,7,13H,1,6,8-11,16H2,2-4H3/t13-,15+/m0/s1 |
| InChIKey | FIHYQYWYCBRWDF-DZGCQCFKSA-N |
| XLogP | 2.57 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|