C16H28N2 — CID 22867714
(6S,8aS)-N,5,5,8a-tetramethyl-2-prop-2-enyl-3,6,7,8-tetrahydro-1H-isoquinolin-6-amine (PubChem CID 22867714) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is (6S,8aS)-N,5,5,8a-tetramethyl-2-prop-2-enyl-3,6,7,8-tetrahydro-1H-isoquinolin-6-amine.
| Compound Name | (6S,8aS)-N,5,5,8a-tetramethyl-2-prop-2-enyl-3,6,7,8-tetrahydro-1H-isoquinolin-6-amine |
|---|---|
| PubChem CID | 22867714 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | (6S,8aS)-N,5,5,8a-tetramethyl-2-prop-2-enyl-3,6,7,8-tetrahydro-1H-isoquinolin-6-amine |
| SMILES | C=CCN1CC=C2C(C)(C)[C@@H](NC)CC[C@]2(C)C1 |
| InChI | InChI=1S/C16H28N2/c1-6-10-18-11-8-13-15(2,3)14(17-5)7-9-16(13,4)12-18/h6,8,14,17H,1,7,9-12H2,2-5H3/t14-,16+/m0/s1 |
| InChIKey | XNIGOHQGIUWIPT-GOEBONIOSA-N |
| XLogP | 2.83 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|