About N-cycloheptyl-N'-propan-2-yloxamide
N-cycloheptyl-N'-propan-2-yloxamide (PubChem CID 2286863) has the molecular formula C12H22N2O2
and a molecular weight of 226.32 g/mol. Its IUPAC name is N-cycloheptyl-N'-propan-2-yloxamide.
Molecular Properties
| Compound Name | N-cycloheptyl-N'-propan-2-yloxamide |
| PubChem CID | 2286863 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | N-cycloheptyl-N'-propan-2-yloxamide |
| SMILES | CC(C)NC(=O)C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C12H22N2O2/c1-9(2)13-11(15)12(16)14-10-7-5-3-4-6-8-10/h9-10H,3-8H2,1-2H3,(H,13,15)(H,14,16) |
| InChIKey | BKYBMZUGMMPFNY-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-cycloheptyl-N'-propan-2-yloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cycloheptyl-N'-propan-2-yloxamide?
The IUPAC name of N-cycloheptyl-N'-propan-2-yloxamide (CID 2286863) is N-cycloheptyl-N'-propan-2-yloxamide.
What is the SMILES notation for N-cycloheptyl-N'-propan-2-yloxamide?
The canonical SMILES for N-cycloheptyl-N'-propan-2-yloxamide is CC(C)NC(=O)C(=O)NC1CCCCCC1.
What is the InChIKey of N-cycloheptyl-N'-propan-2-yloxamide?
The InChIKey is BKYBMZUGMMPFNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O2/c1-9(2)13-11(15)12(16)14-10-7-5-3-4-6-8-10/h9-10H,3-8H2,1-2H3,(H,13,15)(H,14,16).
What are the key properties of N-cycloheptyl-N'-propan-2-yloxamide?
N-cycloheptyl-N'-propan-2-yloxamide has a molecular weight of 226.32 g/mol, XLogP of 1.35, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cycloheptyl-N'-propan-2-yloxamide is sourced from PubChem (CID 2286863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).