C17H23N3O5 — CID 22868947
tert-butyl N-[(3S)-1-[2-(methoxyamino)-2-oxoethyl]-2-oxo-3,4-dihydroquinolin-3-yl]carbamate (PubChem CID 22868947) has the molecular formula C17H23N3O5 and a molecular weight of 349.39 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-[2-(methoxyamino)-2-oxoethyl]-2-oxo-3,4-dihydroquinolin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-[2-(methoxyamino)-2-oxoethyl]-2-oxo-3,4-dihydroquinolin-3-yl]carbamate |
|---|---|
| PubChem CID | 22868947 |
| Molecular Formula | C17H23N3O5 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | tert-butyl N-[(3S)-1-[2-(methoxyamino)-2-oxoethyl]-2-oxo-3,4-dihydroquinolin-3-yl]carbamate |
| SMILES | CONC(=O)CN1C(=O)[C@@H](NC(=O)OC(C)(C)C)Cc2ccccc21 |
| InChI | InChI=1S/C17H23N3O5/c1-17(2,3)25-16(23)18-12-9-11-7-5-6-8-13(11)20(15(12)22)10-14(21)19-24-4/h5-8,12H,9-10H2,1-4H3,(H,18,23)(H,19,21)/t12-/m0/s1 |
| InChIKey | SLOBUSXGASBIDQ-LBPRGKRZSA-N |
| XLogP | 1.15 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|