C17H30O7 — CID 22869091
(5S,6S,7R,8R)-7-methoxy-2,2-dimethyl-6-[(2R,3R)-3-(3-methylbutyl)oxiran-2-yl]-1,3,10-trioxaspiro[4.5]decane-6,8-diol (PubChem CID 22869091) has the molecular formula C17H30O7 and a molecular weight of 346.42 g/mol. Its IUPAC name is (5S,6S,7R,8R)-7-methoxy-2,2-dimethyl-6-[(2R,3R)-3-(3-methylbutyl)oxiran-2-yl]-1,3,10-trioxaspiro[4.5]decane-6,8-diol.
| Compound Name | (5S,6S,7R,8R)-7-methoxy-2,2-dimethyl-6-[(2R,3R)-3-(3-methylbutyl)oxiran-2-yl]-1,3,10-trioxaspiro[4.5]decane-6,8-diol |
|---|---|
| PubChem CID | 22869091 |
| Molecular Formula | C17H30O7 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | (5S,6S,7R,8R)-7-methoxy-2,2-dimethyl-6-[(2R,3R)-3-(3-methylbutyl)oxiran-2-yl]-1,3,10-trioxaspiro[4.5]decane-6,8-diol |
| SMILES | CO[C@@H]1C(O)CO[C@]2(COC(C)(C)O2)[C@@]1(O)[C@@H]1O[C@@H]1CCC(C)C |
| InChI | InChI=1S/C17H30O7/c1-10(2)6-7-12-14(23-12)17(19)13(20-5)11(18)8-21-16(17)9-22-15(3,4)24-16/h10-14,18-19H,6-9H2,1-5H3/t11?,12-,13-,14-,16+,17+/m1/s1 |
| InChIKey | VJIRBUJUEZFDIW-YOKHKGOUSA-N |
| XLogP | 0.81 |
| TPSA | 89.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|