C20H38O6Si — CID 22869106
tert-butyl-[[(5S,6R,7R,8R)-6,7-dimethoxy-2,2-dimethyl-6-prop-1-en-2-yl-1,3,10-trioxaspiro[4.5]decan-8-yl]oxy]-dimethylsilane (PubChem CID 22869106) has the molecular formula C20H38O6Si and a molecular weight of 402.60 g/mol. Its IUPAC name is tert-butyl-[[(5S,6R,7R,8R)-6,7-dimethoxy-2,2-dimethyl-6-prop-1-en-2-yl-1,3,10-trioxaspiro[4.5]decan-8-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(5S,6R,7R,8R)-6,7-dimethoxy-2,2-dimethyl-6-prop-1-en-2-yl-1,3,10-trioxaspiro[4.5]decan-8-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 22869106 |
| Molecular Formula | C20H38O6Si |
| Molecular Weight | 402.60 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | tert-butyl-[[(5S,6R,7R,8R)-6,7-dimethoxy-2,2-dimethyl-6-prop-1-en-2-yl-1,3,10-trioxaspiro[4.5]decan-8-yl]oxy]-dimethylsilane |
| SMILES | C=C(C)[C@@]1(OC)[C@H](OC)[C@H](O[Si](C)(C)C(C)(C)C)CO[C@]12COC(C)(C)O2 |
| InChI | InChI=1S/C20H38O6Si/c1-14(2)20(22-9)16(21-8)15(25-27(10,11)17(3,4)5)12-23-19(20)13-24-18(6,7)26-19/h15-16H,1,12-13H2,2-11H3/t15-,16-,19+,20-/m1/s1 |
| InChIKey | KDTCFLGQQHHZPE-YAJHFMINSA-N |
| XLogP | 3.86 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.60 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|