C28H43NO4Si — CID 22869108
(2R,3R,4R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-(2-ethylbutyl)piperidine-3,4,5-triol (PubChem CID 22869108) has the molecular formula C28H43NO4Si and a molecular weight of 485.74 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-(2-ethylbutyl)piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-(2-ethylbutyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 22869108 |
| Molecular Formula | C28H43NO4Si |
| Molecular Weight | 485.74 g/mol |
| Exact Mass | 485.30 |
| IUPAC Name | (2R,3R,4R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-(2-ethylbutyl)piperidine-3,4,5-triol |
| SMILES | CCC(CC)CN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H43NO4Si/c1-6-21(7-2)18-29-19-25(30)27(32)26(31)24(29)20-33-34(28(3,4)5,22-14-10-8-11-15-22)23-16-12-9-13-17-23/h8-17,21,24-27,30-32H,6-7,18-20H2,1-5H3/t24-,25+,26-,27-/m1/s1 |
| InChIKey | DGVDUSUTAWXACH-HVWQDESWSA-N |
| XLogP | 2.77 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.74 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|