C28H43NO4Si — CID 22869110
(2R,3R,4R,5R)-1-butyl-2-[[3,3-dimethylbutyl(diphenyl)silyl]oxymethyl]-5-(hydroxymethyl)pyrrolidine-3,4-diol (PubChem CID 22869110) has the molecular formula C28H43NO4Si and a molecular weight of 485.74 g/mol. Its IUPAC name is (2R,3R,4R,5R)-1-butyl-2-[[3,3-dimethylbutyl(diphenyl)silyl]oxymethyl]-5-(hydroxymethyl)pyrrolidine-3,4-diol.
| Compound Name | (2R,3R,4R,5R)-1-butyl-2-[[3,3-dimethylbutyl(diphenyl)silyl]oxymethyl]-5-(hydroxymethyl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 22869110 |
| Molecular Formula | C28H43NO4Si |
| Molecular Weight | 485.74 g/mol |
| Exact Mass | 485.30 |
| IUPAC Name | (2R,3R,4R,5R)-1-butyl-2-[[3,3-dimethylbutyl(diphenyl)silyl]oxymethyl]-5-(hydroxymethyl)pyrrolidine-3,4-diol |
| SMILES | CCCCN1[C@H](CO)[C@@H](O)[C@H](O)[C@H]1CO[Si](CCC(C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H43NO4Si/c1-5-6-18-29-24(20-30)26(31)27(32)25(29)21-33-34(19-17-28(2,3)4,22-13-9-7-10-14-22)23-15-11-8-12-16-23/h7-16,24-27,30-32H,5-6,17-21H2,1-4H3/t24-,25-,26-,27-/m1/s1 |
| InChIKey | HRQHXHPGXCJDFC-FPCALVHFSA-N |
| XLogP | 2.77 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.74 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|