C14H20ClN — CID 22869342
(3aR,9bR)-6-ethyl-2,3,3a,4,5,9b-hexahydro-1H-benzo[e]isoindole;hydrochloride (PubChem CID 22869342) has the molecular formula C14H20ClN and a molecular weight of 237.77 g/mol. Its IUPAC name is (3aR,9bR)-6-ethyl-2,3,3a,4,5,9b-hexahydro-1H-benzo[e]isoindole;hydrochloride.
| Compound Name | (3aR,9bR)-6-ethyl-2,3,3a,4,5,9b-hexahydro-1H-benzo[e]isoindole;hydrochloride |
|---|---|
| PubChem CID | 22869342 |
| Molecular Formula | C14H20ClN |
| Molecular Weight | 237.77 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | (3aR,9bR)-6-ethyl-2,3,3a,4,5,9b-hexahydro-1H-benzo[e]isoindole;hydrochloride |
| SMILES | CCc1cccc2c1CC[C@H]1CNC[C@@H]21.Cl |
| InChI | InChI=1S/C14H19N.ClH/c1-2-10-4-3-5-13-12(10)7-6-11-8-15-9-14(11)13;/h3-5,11,14-15H,2,6-9H2,1H3;1H/t11-,14+;/m0./s1 |
| InChIKey | YZIHTNNUCZWLAO-YECZQDJWSA-N |
| XLogP | 2.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.77 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |