C25H44O5 — CID 22869663
[1-[(E,2S)-7-ethyl-7-(methoxymethoxy)non-3-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] methyl carbonate (PubChem CID 22869663) has the molecular formula C25H44O5 and a molecular weight of 424.62 g/mol. Its IUPAC name is [1-[(E,2S)-7-ethyl-7-(methoxymethoxy)non-3-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] methyl carbonate.
| Compound Name | [1-[(E,2S)-7-ethyl-7-(methoxymethoxy)non-3-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] methyl carbonate |
|---|---|
| PubChem CID | 22869663 |
| Molecular Formula | C25H44O5 |
| Molecular Weight | 424.62 g/mol |
| Exact Mass | 424.32 |
| IUPAC Name | [1-[(E,2S)-7-ethyl-7-(methoxymethoxy)non-3-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] methyl carbonate |
| SMILES | CCC(CC)(CC/C=C/[C@H](C)C1CCC2C(OC(=O)OC)CCCC21C)OCOC |
| InChI | InChI=1S/C25H44O5/c1-7-25(8-2,29-18-27-5)17-10-9-12-19(3)20-14-15-21-22(30-23(26)28-6)13-11-16-24(20,21)4/h9,12,19-22H,7-8,10-11,13-18H2,1-6H3/b12-9+/t19-,20?,21?,22?,24?/m0/s1 |
| InChIKey | MWEODAZWFSAIMH-QRSHXDHGSA-N |
| XLogP | 6.51 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.62 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|