C17H38O5Si2 — CID 22869810
(3S,4R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxypentanoic acid (PubChem CID 22869810) has the molecular formula C17H38O5Si2 and a molecular weight of 378.66 g/mol. Its IUPAC name is (3S,4R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxypentanoic acid.
| Compound Name | (3S,4R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxypentanoic acid |
|---|---|
| PubChem CID | 22869810 |
| Molecular Formula | C17H38O5Si2 |
| Molecular Weight | 378.66 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | (3S,4R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxypentanoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@H](CC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H38O5Si2/c1-16(2,3)23(7,8)21-12-13(18)14(11-15(19)20)22-24(9,10)17(4,5)6/h13-14,18H,11-12H2,1-10H3,(H,19,20)/t13-,14+/m1/s1 |
| InChIKey | IQZHHJSSNIZXDP-KGLIPLIRSA-N |
| XLogP | 4.23 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.66 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|