C16H31NO5 — CID 22869862
N-[(3S,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]-8-methylnonanamide (PubChem CID 22869862) has the molecular formula C16H31NO5 and a molecular weight of 317.43 g/mol. Its IUPAC name is N-[(3S,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]-8-methylnonanamide.
| Compound Name | N-[(3S,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]-8-methylnonanamide |
|---|---|
| PubChem CID | 22869862 |
| Molecular Formula | C16H31NO5 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.22 |
| IUPAC Name | N-[(3S,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]-8-methylnonanamide |
| SMILES | CC(C)CCCCCCC(=O)N[C@H]1CO[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H31NO5/c1-11(2)7-5-3-4-6-8-14(19)17-12-10-22-13(9-18)16(21)15(12)20/h11-13,15-16,18,20-21H,3-10H2,1-2H3,(H,17,19)/t12-,13+,15+,16+/m0/s1 |
| InChIKey | RWOGRCXCOTUZBK-SJXGUFTOSA-N |
| XLogP | 0.58 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|