About 2-naphthalen-1-yl-4-piperidin-1-ium-1-yl-2-(2-piperidin-1-ium-1-ylethyl)butanoic acid dichloride
2-naphthalen-1-yl-4-piperidin-1-ium-1-yl-2-(2-piperidin-1-ium-1-ylethyl)butanoic acid dichloride (PubChem CID 22870) has the molecular formula C26H38Cl2N2O2
and a molecular weight of 481.51 g/mol. Its IUPAC name is 2-naphthalen-1-yl-4-piperidin-1-ium-1-yl-2-(2-piperidin-1-ium-1-ylethyl)butanoic acid dichloride.
Molecular Properties
| Compound Name | 2-naphthalen-1-yl-4-piperidin-1-ium-1-yl-2-(2-piperidin-1-ium-1-ylethyl)butanoic acid dichloride |
| PubChem CID | 22870 |
| Molecular Formula | C26H38Cl2N2O2 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | 2-naphthalen-1-yl-4-piperidin-1-ium-1-yl-2-(2-piperidin-1-ium-1-ylethyl)butanoic acid dichloride |
| SMILES | O=C(O)C(CC[NH+]1CCCCC1)(CC[NH+]1CCCCC1)c1cccc2ccccc12.[Cl-].[Cl-] |
| InChI | InChI=1S/C26H36N2O2.2ClH/c29-25(30)26(14-20-27-16-5-1-6-17-27,15-21-28-18-7-2-8-19-28)24-13-9-11-22-10-3-4-12-23(22)24;;/h3-4,9-13H,1-2,5-8,14-21H2,(H,29,30);2*1H |
| InChIKey | JEIWOAARDKXESR-UHFFFAOYSA-N |
| XLogP | -3.91 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | -3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-naphthalen-1-yl-4-piperidin-1-ium-1-yl-2-(2-piperidin-1-ium-1-ylethyl)butanoic acid dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-naphthalen-1-yl-4-piperidin-1-ium-1-yl-2-(2-piperidin-1-ium-1-ylethyl)butanoic acid dichloride?
The IUPAC name of 2-naphthalen-1-yl-4-piperidin-1-ium-1-yl-2-(2-piperidin-1-ium-1-ylethyl)butanoic acid dichloride (CID 22870) is 2-naphthalen-1-yl-4-piperidin-1-ium-1-yl-2-(2-piperidin-1-ium-1-ylethyl)butanoic acid dichloride.
What is the SMILES notation for 2-naphthalen-1-yl-4-piperidin-1-ium-1-yl-2-(2-piperidin-1-ium-1-ylethyl)butanoic acid dichloride?
The canonical SMILES for 2-naphthalen-1-yl-4-piperidin-1-ium-1-yl-2-(2-piperidin-1-ium-1-ylethyl)butanoic acid dichloride is O=C(O)C(CC[NH+]1CCCCC1)(CC[NH+]1CCCCC1)c1cccc2ccccc12.[Cl-].[Cl-].
What is the InChIKey of 2-naphthalen-1-yl-4-piperidin-1-ium-1-yl-2-(2-piperidin-1-ium-1-ylethyl)butanoic acid dichloride?
The InChIKey is JEIWOAARDKXESR-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H36N2O2.2ClH/c29-25(30)26(14-20-27-16-5-1-6-17-27,15-21-28-18-7-2-8-19-28)24-13-9-11-22-10-3-4-12-23(22)24;;/h3-4,9-13H,1-2,5-8,14-21H2,(H,29,30);2*1H.
What are the key properties of 2-naphthalen-1-yl-4-piperidin-1-ium-1-yl-2-(2-piperidin-1-ium-1-ylethyl)butanoic acid dichloride?
2-naphthalen-1-yl-4-piperidin-1-ium-1-yl-2-(2-piperidin-1-ium-1-ylethyl)butanoic acid dichloride has a molecular weight of 481.51 g/mol, XLogP of -3.91, 8 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-naphthalen-1-yl-4-piperidin-1-ium-1-yl-2-(2-piperidin-1-ium-1-ylethyl)butanoic acid dichloride is sourced from PubChem (CID 22870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).