C32H41N5O5 — CID 22870096
2-[4-[[(6R)-6-[[3-[[(2S)-2,3-dihydroxypropyl]amino]-3-methylbutanoyl]amino]-5-oxo-1,6,7,8-tetrahydropyrrolo[3,2-b]azepin-4-yl]methyl]phenyl]-N-ethylbenzamide (PubChem CID 22870096) has the molecular formula C32H41N5O5 and a molecular weight of 575.71 g/mol. Its IUPAC name is 2-[4-[[(6R)-6-[[3-[[(2S)-2,3-dihydroxypropyl]amino]-3-methylbutanoyl]amino]-5-oxo-1,6,7,8-tetrahydropyrrolo[3,2-b]azepin-4-yl]methyl]phenyl]-N-ethylbenzamide.
| Compound Name | 2-[4-[[(6R)-6-[[3-[[(2S)-2,3-dihydroxypropyl]amino]-3-methylbutanoyl]amino]-5-oxo-1,6,7,8-tetrahydropyrrolo[3,2-b]azepin-4-yl]methyl]phenyl]-N-ethylbenzamide |
|---|---|
| PubChem CID | 22870096 |
| Molecular Formula | C32H41N5O5 |
| Molecular Weight | 575.71 g/mol |
| Exact Mass | 575.31 |
| IUPAC Name | 2-[4-[[(6R)-6-[[3-[[(2S)-2,3-dihydroxypropyl]amino]-3-methylbutanoyl]amino]-5-oxo-1,6,7,8-tetrahydropyrrolo[3,2-b]azepin-4-yl]methyl]phenyl]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1ccccc1-c1ccc(CN2C(=O)[C@H](NC(=O)CC(C)(C)NC[C@H](O)CO)CCc3[nH]ccc32)cc1 |
| InChI | InChI=1S/C32H41N5O5/c1-4-33-30(41)25-8-6-5-7-24(25)22-11-9-21(10-12-22)19-37-28-15-16-34-26(28)13-14-27(31(37)42)36-29(40)17-32(2,3)35-18-23(39)20-38/h5-12,15-16,23,27,34-35,38-39H,4,13-14,17-20H2,1-3H3,(H,33,41)(H,36,40)/t23-,27+/m0/s1 |
| InChIKey | WFKBHGBRICRXHJ-WNCULLNHSA-N |
| XLogP | 2.51 |
| TPSA | 146.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.71 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |