About N-[2-(cyclohexen-1-yl)ethyl]-N'-cyclopentyloxamide
N-[2-(cyclohexen-1-yl)ethyl]-N'-cyclopentyloxamide (PubChem CID 2287078) has the molecular formula C15H24N2O2
and a molecular weight of 264.37 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-N'-cyclopentyloxamide.
Molecular Properties
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-N'-cyclopentyloxamide |
| PubChem CID | 2287078 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-N'-cyclopentyloxamide |
| SMILES | O=C(NCCC1=CCCCC1)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C15H24N2O2/c18-14(15(19)17-13-8-4-5-9-13)16-11-10-12-6-2-1-3-7-12/h6,13H,1-5,7-11H2,(H,16,18)(H,17,19) |
| InChIKey | QODJVWPZSZRLAQ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(cyclohexen-1-yl)ethyl]-N'-cyclopentyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(cyclohexen-1-yl)ethyl]-N'-cyclopentyloxamide?
The IUPAC name of N-[2-(cyclohexen-1-yl)ethyl]-N'-cyclopentyloxamide (CID 2287078) is N-[2-(cyclohexen-1-yl)ethyl]-N'-cyclopentyloxamide.
What is the SMILES notation for N-[2-(cyclohexen-1-yl)ethyl]-N'-cyclopentyloxamide?
The canonical SMILES for N-[2-(cyclohexen-1-yl)ethyl]-N'-cyclopentyloxamide is O=C(NCCC1=CCCCC1)C(=O)NC1CCCC1.
What is the InChIKey of N-[2-(cyclohexen-1-yl)ethyl]-N'-cyclopentyloxamide?
The InChIKey is QODJVWPZSZRLAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O2/c18-14(15(19)17-13-8-4-5-9-13)16-11-10-12-6-2-1-3-7-12/h6,13H,1-5,7-11H2,(H,16,18)(H,17,19).
What are the key properties of N-[2-(cyclohexen-1-yl)ethyl]-N'-cyclopentyloxamide?
N-[2-(cyclohexen-1-yl)ethyl]-N'-cyclopentyloxamide has a molecular weight of 264.37 g/mol, XLogP of 2.05, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(cyclohexen-1-yl)ethyl]-N'-cyclopentyloxamide is sourced from PubChem (CID 2287078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).