C15H19N3O4S3 — CID 22871575
(4S,7S,9aS)-5-oxo-4-[[2-sulfanyl-3-(1,3-thiazol-4-yl)propanoyl]amino]-3,4,7,8,9,9a-hexahydro-2H-pyrrolo[2,1-b][1,3]thiazepine-7-carboxylic acid (PubChem CID 22871575) has the molecular formula C15H19N3O4S3 and a molecular weight of 401.54 g/mol. Its IUPAC name is (4S,7S,9aS)-5-oxo-4-[[2-sulfanyl-3-(1,3-thiazol-4-yl)propanoyl]amino]-3,4,7,8,9,9a-hexahydro-2H-pyrrolo[2,1-b][1,3]thiazepine-7-carboxylic acid.
| Compound Name | (4S,7S,9aS)-5-oxo-4-[[2-sulfanyl-3-(1,3-thiazol-4-yl)propanoyl]amino]-3,4,7,8,9,9a-hexahydro-2H-pyrrolo[2,1-b][1,3]thiazepine-7-carboxylic acid |
|---|---|
| PubChem CID | 22871575 |
| Molecular Formula | C15H19N3O4S3 |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | (4S,7S,9aS)-5-oxo-4-[[2-sulfanyl-3-(1,3-thiazol-4-yl)propanoyl]amino]-3,4,7,8,9,9a-hexahydro-2H-pyrrolo[2,1-b][1,3]thiazepine-7-carboxylic acid |
| SMILES | O=C(N[C@H]1CCS[C@H]2CC[C@@H](C(=O)O)N2C1=O)C(S)Cc1cscn1 |
| InChI | InChI=1S/C15H19N3O4S3/c19-13(11(23)5-8-6-24-7-16-8)17-9-3-4-25-12-2-1-10(15(21)22)18(12)14(9)20/h6-7,9-12,23H,1-5H2,(H,17,19)(H,21,22)/t9-,10-,11?,12-/m0/s1 |
| InChIKey | VYPPNVHLIYADPM-NTUYEHIUSA-N |
| XLogP | 1.01 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|