C32H31F3O5S — CID 22871647
trifluoromethyl (8S,9S,13S,14S,17S)-13-methyl-17-(4-phenoxybenzoyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-sulfonate (PubChem CID 22871647) has the molecular formula C32H31F3O5S and a molecular weight of 584.66 g/mol. Its IUPAC name is trifluoromethyl (8S,9S,13S,14S,17S)-13-methyl-17-(4-phenoxybenzoyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-sulfonate.
| Compound Name | trifluoromethyl (8S,9S,13S,14S,17S)-13-methyl-17-(4-phenoxybenzoyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-sulfonate |
|---|---|
| PubChem CID | 22871647 |
| Molecular Formula | C32H31F3O5S |
| Molecular Weight | 584.66 g/mol |
| Exact Mass | 584.18 |
| IUPAC Name | trifluoromethyl (8S,9S,13S,14S,17S)-13-methyl-17-(4-phenoxybenzoyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-sulfonate |
| SMILES | C[C@]12CC[C@@H]3c4ccc(S(=O)(=O)OC(F)(F)F)cc4CC[C@H]3[C@@H]1CC[C@@H]2C(=O)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C32H31F3O5S/c1-31-18-17-26-25-14-12-24(41(37,38)40-32(33,34)35)19-21(25)9-13-27(26)28(31)15-16-29(31)30(36)20-7-10-23(11-8-20)39-22-5-3-2-4-6-22/h2-8,10-12,14,19,26-29H,9,13,15-18H2,1H3/t26-,27-,28+,29-,31+/m1/s1 |
| InChIKey | SAYGODDADWXXQP-KBMGTAGUSA-N |
| XLogP | 8.06 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.66 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|