C26H31N5O2 — CID 22871744
1-[5-[(3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-3-(3-methylphenyl)urea (PubChem CID 22871744) has the molecular formula C26H31N5O2 and a molecular weight of 445.57 g/mol. Its IUPAC name is 1-[5-[(3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-3-(3-methylphenyl)urea.
| Compound Name | 1-[5-[(3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-3-(3-methylphenyl)urea |
|---|---|
| PubChem CID | 22871744 |
| Molecular Formula | C26H31N5O2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | 1-[5-[(3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]-3-(3-methylphenyl)urea |
| SMILES | Cc1cccc(NC(=O)NC2N=C(N3C[C@H]4CCCC[C@H]4C3)c3ccccc3N(C)C2=O)c1 |
| InChI | InChI=1S/C26H31N5O2/c1-17-8-7-11-20(14-17)27-26(33)29-23-25(32)30(2)22-13-6-5-12-21(22)24(28-23)31-15-18-9-3-4-10-19(18)16-31/h5-8,11-14,18-19,23H,3-4,9-10,15-16H2,1-2H3,(H2,27,29,33)/t18-,19+,23? |
| InChIKey | KUNASXOQHHHKEZ-LIMIJEPZSA-N |
| XLogP | 3.99 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |