C24H34N2O7 — CID 22872504
6-[(3aS,4R,5R,7aR)-4-amino-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl]-4-(ethoxymethoxy)-N,N-diethyl-1,3-benzodioxole-5-carboxamide (PubChem CID 22872504) has the molecular formula C24H34N2O7 and a molecular weight of 462.54 g/mol. Its IUPAC name is 6-[(3aS,4R,5R,7aR)-4-amino-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl]-4-(ethoxymethoxy)-N,N-diethyl-1,3-benzodioxole-5-carboxamide.
| Compound Name | 6-[(3aS,4R,5R,7aR)-4-amino-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl]-4-(ethoxymethoxy)-N,N-diethyl-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 22872504 |
| Molecular Formula | C24H34N2O7 |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | 6-[(3aS,4R,5R,7aR)-4-amino-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl]-4-(ethoxymethoxy)-N,N-diethyl-1,3-benzodioxole-5-carboxamide |
| SMILES | CCOCOc1c2c(cc([C@H]3C=C[C@H]4OC(C)(C)O[C@H]4[C@@H]3N)c1C(=O)N(CC)CC)OCO2 |
| InChI | InChI=1S/C24H34N2O7/c1-6-26(7-2)23(27)18-15(11-17-21(31-13-29-17)22(18)30-12-28-8-3)14-9-10-16-20(19(14)25)33-24(4,5)32-16/h9-11,14,16,19-20H,6-8,12-13,25H2,1-5H3/t14-,16-,19-,20-/m1/s1 |
| InChIKey | FOWHJHZRZMJOIA-BGRCLHOASA-N |
| XLogP | 2.77 |
| TPSA | 101.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|