About (1R,2S)-2-(3,4-dichlorophenyl)-1-(3-phenyltriazol-4-yl)pent-4-en-1-ol
(1R,2S)-2-(3,4-dichlorophenyl)-1-(3-phenyltriazol-4-yl)pent-4-en-1-ol (PubChem CID 22873117) has the molecular formula C19H17Cl2N3O
and a molecular weight of 374.27 g/mol. Its IUPAC name is (1R,2S)-2-(3,4-dichlorophenyl)-1-(3-phenyltriazol-4-yl)pent-4-en-1-ol.
Molecular Properties
| Compound Name | (1R,2S)-2-(3,4-dichlorophenyl)-1-(3-phenyltriazol-4-yl)pent-4-en-1-ol |
| PubChem CID | 22873117 |
| Molecular Formula | C19H17Cl2N3O |
| Molecular Weight | 374.27 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | (1R,2S)-2-(3,4-dichlorophenyl)-1-(3-phenyltriazol-4-yl)pent-4-en-1-ol |
| SMILES | C=CC[C@@H](c1ccc(Cl)c(Cl)c1)[C@@H](O)c1cnnn1-c1ccccc1 |
| InChI | InChI=1S/C19H17Cl2N3O/c1-2-6-15(13-9-10-16(20)17(21)11-13)19(25)18-12-22-23-24(18)14-7-4-3-5-8-14/h2-5,7-12,15,19,25H,1,6H2/t15-,19+/m0/s1 |
| InChIKey | MVFPADKERJRUSL-HNAYVOBHSA-N |
| XLogP | 4.97 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.27 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1R,2S)-2-(3,4-dichlorophenyl)-1-(3-phenyltriazol-4-yl)pent-4-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2S)-2-(3,4-dichlorophenyl)-1-(3-phenyltriazol-4-yl)pent-4-en-1-ol?
The IUPAC name of (1R,2S)-2-(3,4-dichlorophenyl)-1-(3-phenyltriazol-4-yl)pent-4-en-1-ol (CID 22873117) is (1R,2S)-2-(3,4-dichlorophenyl)-1-(3-phenyltriazol-4-yl)pent-4-en-1-ol.
What is the SMILES notation for (1R,2S)-2-(3,4-dichlorophenyl)-1-(3-phenyltriazol-4-yl)pent-4-en-1-ol?
The canonical SMILES for (1R,2S)-2-(3,4-dichlorophenyl)-1-(3-phenyltriazol-4-yl)pent-4-en-1-ol is C=CC[C@@H](c1ccc(Cl)c(Cl)c1)[C@@H](O)c1cnnn1-c1ccccc1.
What is the InChIKey of (1R,2S)-2-(3,4-dichlorophenyl)-1-(3-phenyltriazol-4-yl)pent-4-en-1-ol?
The InChIKey is MVFPADKERJRUSL-HNAYVOBHSA-N. The full InChI is InChI=1S/C19H17Cl2N3O/c1-2-6-15(13-9-10-16(20)17(21)11-13)19(25)18-12-22-23-24(18)14-7-4-3-5-8-14/h2-5,7-12,15,19,25H,1,6H2/t15-,19+/m0/s1.
What are the key properties of (1R,2S)-2-(3,4-dichlorophenyl)-1-(3-phenyltriazol-4-yl)pent-4-en-1-ol?
(1R,2S)-2-(3,4-dichlorophenyl)-1-(3-phenyltriazol-4-yl)pent-4-en-1-ol has a molecular weight of 374.27 g/mol, XLogP of 4.97, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2S)-2-(3,4-dichlorophenyl)-1-(3-phenyltriazol-4-yl)pent-4-en-1-ol is sourced from PubChem (CID 22873117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).