C12H13NO4S — CID 22873183
(2S,3S,5R)-3-methyl-7-oxo-3-[(1E,3E)-5-oxopenta-1,3-dienyl]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 22873183) has the molecular formula C12H13NO4S and a molecular weight of 267.31 g/mol. Its IUPAC name is (2S,3S,5R)-3-methyl-7-oxo-3-[(1E,3E)-5-oxopenta-1,3-dienyl]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,3S,5R)-3-methyl-7-oxo-3-[(1E,3E)-5-oxopenta-1,3-dienyl]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 22873183 |
| Molecular Formula | C12H13NO4S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | (2S,3S,5R)-3-methyl-7-oxo-3-[(1E,3E)-5-oxopenta-1,3-dienyl]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | C[C@@]1(/C=C/C=C/C=O)S[C@@H]2CC(=O)N2[C@H]1C(=O)O |
| InChI | InChI=1S/C12H13NO4S/c1-12(5-3-2-4-6-14)10(11(16)17)13-8(15)7-9(13)18-12/h2-6,9-10H,7H2,1H3,(H,16,17)/b4-2+,5-3+/t9-,10+,12+/m1/s1 |
| InChIKey | KTUVTYWGPJPMNZ-AZNCBKDXSA-N |
| XLogP | 0.81 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|