C18H26O11 — CID 22873514
(2S,3R,4R,5S,6R)-6-(hydroxymethyl)-5-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(phenoxymethyl)oxan-2-yl]oxyoxane-2,3,4-triol (PubChem CID 22873514) has the molecular formula C18H26O11 and a molecular weight of 418.40 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-6-(hydroxymethyl)-5-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(phenoxymethyl)oxan-2-yl]oxyoxane-2,3,4-triol.
| Compound Name | (2S,3R,4R,5S,6R)-6-(hydroxymethyl)-5-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(phenoxymethyl)oxan-2-yl]oxyoxane-2,3,4-triol |
|---|---|
| PubChem CID | 22873514 |
| Molecular Formula | C18H26O11 |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | (2S,3R,4R,5S,6R)-6-(hydroxymethyl)-5-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(phenoxymethyl)oxan-2-yl]oxyoxane-2,3,4-triol |
| SMILES | OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](COc2ccccc2)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C18H26O11/c19-6-9-16(13(22)14(23)17(25)27-9)29-18-15(24)12(21)11(20)10(28-18)7-26-8-4-2-1-3-5-8/h1-5,9-25H,6-7H2/t9-,10-,11+,12+,13-,14-,15-,16-,17+,18+/m1/s1 |
| InChIKey | RFNFYJVSVZGZNJ-XZILNXCWSA-N |
| XLogP | -3.31 |
| TPSA | 178.53 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | -3.31 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |