C5H9NO2S — CID 22873760
(2S,4S)-4-sulfanylpyrrolidine-2-carboxylic acid (PubChem CID 22873760) has the molecular formula C5H9NO2S and a molecular weight of 147.20 g/mol. Its IUPAC name is (2S,4S)-4-sulfanylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4S)-4-sulfanylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 22873760 |
| Molecular Formula | C5H9NO2S |
| Molecular Weight | 147.20 g/mol |
| Exact Mass | 147.04 |
| IUPAC Name | (2S,4S)-4-sulfanylpyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C[C@H](S)CN1 |
| InChI | InChI=1S/C5H9NO2S/c7-5(8)4-1-3(9)2-6-4/h3-4,6,9H,1-2H2,(H,7,8)/t3-,4-/m0/s1 |
| InChIKey | OYNANFOWNSGDJL-IMJSIDKUSA-N |
| XLogP | -0.27 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.20 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|