C27H42F3N3O5 — CID 22874080
[2-[[(2S,4S,5S,7S)-4-amino-7-(butylcarbamoyl)-5-hydroxy-8-methyl-2-propan-2-ylnonyl]carbamoyl]phenyl] 2,2,2-trifluoroacetate (PubChem CID 22874080) has the molecular formula C27H42F3N3O5 and a molecular weight of 545.64 g/mol. Its IUPAC name is [2-[[(2S,4S,5S,7S)-4-amino-7-(butylcarbamoyl)-5-hydroxy-8-methyl-2-propan-2-ylnonyl]carbamoyl]phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[[(2S,4S,5S,7S)-4-amino-7-(butylcarbamoyl)-5-hydroxy-8-methyl-2-propan-2-ylnonyl]carbamoyl]phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 22874080 |
| Molecular Formula | C27H42F3N3O5 |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.31 |
| IUPAC Name | [2-[[(2S,4S,5S,7S)-4-amino-7-(butylcarbamoyl)-5-hydroxy-8-methyl-2-propan-2-ylnonyl]carbamoyl]phenyl] 2,2,2-trifluoroacetate |
| SMILES | CCCCNC(=O)[C@@H](C[C@H](O)[C@@H](N)C[C@H](CNC(=O)c1ccccc1OC(=O)C(F)(F)F)C(C)C)C(C)C |
| InChI | InChI=1S/C27H42F3N3O5/c1-6-7-12-32-25(36)20(17(4)5)14-22(34)21(31)13-18(16(2)3)15-33-24(35)19-10-8-9-11-23(19)38-26(37)27(28,29)30/h8-11,16-18,20-22,34H,6-7,12-15,31H2,1-5H3,(H,32,36)(H,33,35)/t18-,20+,21+,22+/m1/s1 |
| InChIKey | LCKRZQRUCLPGHB-GBAJDQEWSA-N |
| XLogP | 3.81 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|