C13H13NO3 — CID 22874112
(3R,3aS)-3-ethenyl-7-hydroxy-3,3a,4,5-tetrahydro-[1,3]oxazolo[3,4-a]quinolin-1-one (PubChem CID 22874112) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is (3R,3aS)-3-ethenyl-7-hydroxy-3,3a,4,5-tetrahydro-[1,3]oxazolo[3,4-a]quinolin-1-one.
| Compound Name | (3R,3aS)-3-ethenyl-7-hydroxy-3,3a,4,5-tetrahydro-[1,3]oxazolo[3,4-a]quinolin-1-one |
|---|---|
| PubChem CID | 22874112 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | (3R,3aS)-3-ethenyl-7-hydroxy-3,3a,4,5-tetrahydro-[1,3]oxazolo[3,4-a]quinolin-1-one |
| SMILES | C=C[C@H]1OC(=O)N2c3ccc(O)cc3CC[C@@H]12 |
| InChI | InChI=1S/C13H13NO3/c1-2-12-11-5-3-8-7-9(15)4-6-10(8)14(11)13(16)17-12/h2,4,6-7,11-12,15H,1,3,5H2/t11-,12+/m0/s1 |
| InChIKey | QODMPEABZLSYGG-NWDGAFQWSA-N |
| XLogP | 2.22 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|