About 1-[(2R)-2-azidopropyl]-4H-chromeno[4,3-b]pyrrole
1-[(2R)-2-azidopropyl]-4H-chromeno[4,3-b]pyrrole (PubChem CID 22874713) has the molecular formula C14H14N4O
and a molecular weight of 254.29 g/mol. Its IUPAC name is 1-[(2R)-2-azidopropyl]-4H-chromeno[4,3-b]pyrrole.
Molecular Properties
| Compound Name | 1-[(2R)-2-azidopropyl]-4H-chromeno[4,3-b]pyrrole |
| PubChem CID | 22874713 |
| Molecular Formula | C14H14N4O |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 1-[(2R)-2-azidopropyl]-4H-chromeno[4,3-b]pyrrole |
| SMILES | C[C@H](Cn1ccc2c1-c1ccccc1OC2)N=[N+]=[N-] |
| InChI | InChI=1S/C14H14N4O/c1-10(16-17-15)8-18-7-6-11-9-19-13-5-3-2-4-12(13)14(11)18/h2-7,10H,8-9H2,1H3/t10-/m1/s1 |
| InChIKey | GBZRHTVQPVSCAL-SNVBAGLBSA-N |
| XLogP | 3.75 |
| TPSA | 62.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2R)-2-azidopropyl]-4H-chromeno[4,3-b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2R)-2-azidopropyl]-4H-chromeno[4,3-b]pyrrole?
The IUPAC name of 1-[(2R)-2-azidopropyl]-4H-chromeno[4,3-b]pyrrole (CID 22874713) is 1-[(2R)-2-azidopropyl]-4H-chromeno[4,3-b]pyrrole.
What is the SMILES notation for 1-[(2R)-2-azidopropyl]-4H-chromeno[4,3-b]pyrrole?
The canonical SMILES for 1-[(2R)-2-azidopropyl]-4H-chromeno[4,3-b]pyrrole is C[C@H](Cn1ccc2c1-c1ccccc1OC2)N=[N+]=[N-].
What is the InChIKey of 1-[(2R)-2-azidopropyl]-4H-chromeno[4,3-b]pyrrole?
The InChIKey is GBZRHTVQPVSCAL-SNVBAGLBSA-N. The full InChI is InChI=1S/C14H14N4O/c1-10(16-17-15)8-18-7-6-11-9-19-13-5-3-2-4-12(13)14(11)18/h2-7,10H,8-9H2,1H3/t10-/m1/s1.
What are the key properties of 1-[(2R)-2-azidopropyl]-4H-chromeno[4,3-b]pyrrole?
1-[(2R)-2-azidopropyl]-4H-chromeno[4,3-b]pyrrole has a molecular weight of 254.29 g/mol, XLogP of 3.75, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2R)-2-azidopropyl]-4H-chromeno[4,3-b]pyrrole is sourced from PubChem (CID 22874713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).