C9H18O5 — CID 22875615
(2S,3R,4R,5S)-5-hydroxy-2,3,4-trimethoxyhexanal (PubChem CID 22875615) has the molecular formula C9H18O5 and a molecular weight of 206.24 g/mol. Its IUPAC name is (2S,3R,4R,5S)-5-hydroxy-2,3,4-trimethoxyhexanal.
| Compound Name | (2S,3R,4R,5S)-5-hydroxy-2,3,4-trimethoxyhexanal |
|---|---|
| PubChem CID | 22875615 |
| Molecular Formula | C9H18O5 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | (2S,3R,4R,5S)-5-hydroxy-2,3,4-trimethoxyhexanal |
| SMILES | CO[C@H]([C@H](OC)[C@H](C)O)[C@@H](C=O)OC |
| InChI | InChI=1S/C9H18O5/c1-6(11)8(13-3)9(14-4)7(5-10)12-2/h5-9,11H,1-4H3/t6-,7+,8+,9-/m0/s1 |
| InChIKey | INLBZNIJYWDUQM-KDXUFGMBSA-N |
| XLogP | -0.39 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|