C36H40F2N8O4 — CID 22875876
4-[4-[4-[4-[[(3S,5S)-5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-2-[(2R)-4-hydroxybutan-2-yl]-1,2,4-triazol-3-one (PubChem CID 22875876) has the molecular formula C36H40F2N8O4 and a molecular weight of 686.76 g/mol. Its IUPAC name is 4-[4-[4-[4-[[(3S,5S)-5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-2-[(2R)-4-hydroxybutan-2-yl]-1,2,4-triazol-3-one.
| Compound Name | 4-[4-[4-[4-[[(3S,5S)-5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-2-[(2R)-4-hydroxybutan-2-yl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 22875876 |
| Molecular Formula | C36H40F2N8O4 |
| Molecular Weight | 686.76 g/mol |
| Exact Mass | 686.31 |
| IUPAC Name | 4-[4-[4-[4-[[(3S,5S)-5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-2-[(2R)-4-hydroxybutan-2-yl]-1,2,4-triazol-3-one |
| SMILES | C[C@H](CCO)n1ncn(-c2ccc(N3CCN(c4ccc(OC[C@H]5CO[C@](Cn6cncn6)(c6ccc(F)cc6F)C5)cc4)CC3)cc2)c1=O |
| InChI | InChI=1S/C36H40F2N8O4/c1-26(12-17-47)46-35(48)45(25-41-46)31-5-3-29(4-6-31)42-13-15-43(16-14-42)30-7-9-32(10-8-30)49-20-27-19-36(50-21-27,22-44-24-39-23-40-44)33-11-2-28(37)18-34(33)38/h2-11,18,23-27,47H,12-17,19-22H2,1H3/t26-,27+,36-/m1/s1 |
| InChIKey | FORAJSMFCBTOQT-IGHHUVOLSA-N |
| XLogP | 4.18 |
| TPSA | 115.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.76 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|