C25H35N5O5S — CID 22875936
(2S)-2-[[2-[[(2S)-1-[2-(1H-imidazol-5-yl)acetyl]pyrrolidin-2-yl]methyl-[(3-methoxyphenyl)methyl]amino]acetyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 22875936) has the molecular formula C25H35N5O5S and a molecular weight of 517.65 g/mol. Its IUPAC name is (2S)-2-[[2-[[(2S)-1-[2-(1H-imidazol-5-yl)acetyl]pyrrolidin-2-yl]methyl-[(3-methoxyphenyl)methyl]amino]acetyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[[2-[[(2S)-1-[2-(1H-imidazol-5-yl)acetyl]pyrrolidin-2-yl]methyl-[(3-methoxyphenyl)methyl]amino]acetyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 22875936 |
| Molecular Formula | C25H35N5O5S |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | (2S)-2-[[2-[[(2S)-1-[2-(1H-imidazol-5-yl)acetyl]pyrrolidin-2-yl]methyl-[(3-methoxyphenyl)methyl]amino]acetyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | COc1cccc(CN(CC(=O)N[C@@H](CCSC)C(=O)O)C[C@@H]2CCCN2C(=O)Cc2cnc[nH]2)c1 |
| InChI | InChI=1S/C25H35N5O5S/c1-35-21-7-3-5-18(11-21)14-29(16-23(31)28-22(25(33)34)8-10-36-2)15-20-6-4-9-30(20)24(32)12-19-13-26-17-27-19/h3,5,7,11,13,17,20,22H,4,6,8-10,12,14-16H2,1-2H3,(H,26,27)(H,28,31)(H,33,34)/t20-,22-/m0/s1 |
| InChIKey | NAPKHUSBDHTYQA-UNMCSNQZSA-N |
| XLogP | 1.78 |
| TPSA | 127.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |