About 5-[(E)-but-1-enyl]-2-[2-(4-fluorocyclohex-3-en-1-yl)ethyl]-1,3-dioxane
5-[(E)-but-1-enyl]-2-[2-(4-fluorocyclohex-3-en-1-yl)ethyl]-1,3-dioxane (PubChem CID 22876091) has the molecular formula C16H25FO2
and a molecular weight of 268.37 g/mol. Its IUPAC name is 5-[(E)-but-1-enyl]-2-[2-(4-fluorocyclohex-3-en-1-yl)ethyl]-1,3-dioxane.
Molecular Properties
| Compound Name | 5-[(E)-but-1-enyl]-2-[2-(4-fluorocyclohex-3-en-1-yl)ethyl]-1,3-dioxane |
| PubChem CID | 22876091 |
| Molecular Formula | C16H25FO2 |
| Molecular Weight | 268.37 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 5-[(E)-but-1-enyl]-2-[2-(4-fluorocyclohex-3-en-1-yl)ethyl]-1,3-dioxane |
| SMILES | CC/C=C/C1COC(CCC2CC=C(F)CC2)OC1 |
| InChI | InChI=1S/C16H25FO2/c1-2-3-4-14-11-18-16(19-12-14)10-7-13-5-8-15(17)9-6-13/h3-4,8,13-14,16H,2,5-7,9-12H2,1H3/b4-3+ |
| InChIKey | PHMQXNJJSNATNP-ONEGZZNKSA-N |
| XLogP | 4.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.37 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(E)-but-1-enyl]-2-[2-(4-fluorocyclohex-3-en-1-yl)ethyl]-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(E)-but-1-enyl]-2-[2-(4-fluorocyclohex-3-en-1-yl)ethyl]-1,3-dioxane?
The IUPAC name of 5-[(E)-but-1-enyl]-2-[2-(4-fluorocyclohex-3-en-1-yl)ethyl]-1,3-dioxane (CID 22876091) is 5-[(E)-but-1-enyl]-2-[2-(4-fluorocyclohex-3-en-1-yl)ethyl]-1,3-dioxane.
What is the SMILES notation for 5-[(E)-but-1-enyl]-2-[2-(4-fluorocyclohex-3-en-1-yl)ethyl]-1,3-dioxane?
The canonical SMILES for 5-[(E)-but-1-enyl]-2-[2-(4-fluorocyclohex-3-en-1-yl)ethyl]-1,3-dioxane is CC/C=C/C1COC(CCC2CC=C(F)CC2)OC1.
What is the InChIKey of 5-[(E)-but-1-enyl]-2-[2-(4-fluorocyclohex-3-en-1-yl)ethyl]-1,3-dioxane?
The InChIKey is PHMQXNJJSNATNP-ONEGZZNKSA-N. The full InChI is InChI=1S/C16H25FO2/c1-2-3-4-14-11-18-16(19-12-14)10-7-13-5-8-15(17)9-6-13/h3-4,8,13-14,16H,2,5-7,9-12H2,1H3/b4-3+.
What are the key properties of 5-[(E)-but-1-enyl]-2-[2-(4-fluorocyclohex-3-en-1-yl)ethyl]-1,3-dioxane?
5-[(E)-but-1-enyl]-2-[2-(4-fluorocyclohex-3-en-1-yl)ethyl]-1,3-dioxane has a molecular weight of 268.37 g/mol, XLogP of 4.38, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(E)-but-1-enyl]-2-[2-(4-fluorocyclohex-3-en-1-yl)ethyl]-1,3-dioxane is sourced from PubChem (CID 22876091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).