C21H25F2NO2S — CID 22876245
(3R,5S)-3-butyl-5-(3,4-difluorophenyl)-3-ethyl-4,5-dihydro-2H-1λ6,4-benzothiazepine 1,1-dioxide (PubChem CID 22876245) has the molecular formula C21H25F2NO2S and a molecular weight of 393.50 g/mol. Its IUPAC name is (3R,5S)-3-butyl-5-(3,4-difluorophenyl)-3-ethyl-4,5-dihydro-2H-1λ6,4-benzothiazepine 1,1-dioxide.
| Compound Name | (3R,5S)-3-butyl-5-(3,4-difluorophenyl)-3-ethyl-4,5-dihydro-2H-1λ6,4-benzothiazepine 1,1-dioxide |
|---|---|
| PubChem CID | 22876245 |
| Molecular Formula | C21H25F2NO2S |
| Molecular Weight | 393.50 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | (3R,5S)-3-butyl-5-(3,4-difluorophenyl)-3-ethyl-4,5-dihydro-2H-1λ6,4-benzothiazepine 1,1-dioxide |
| SMILES | CCCC[C@]1(CC)CS(=O)(=O)c2ccccc2[C@H](c2ccc(F)c(F)c2)N1 |
| InChI | InChI=1S/C21H25F2NO2S/c1-3-5-12-21(4-2)14-27(25,26)19-9-7-6-8-16(19)20(24-21)15-10-11-17(22)18(23)13-15/h6-11,13,20,24H,3-5,12,14H2,1-2H3/t20-,21+/m0/s1 |
| InChIKey | JRHPMKPLCOJXLP-LEWJYISDSA-N |
| XLogP | 4.77 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.50 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |