About (2S)-2-amino-5-(ethylamino)-5-oxopentanoic acid;(2S)-2-amino-4-methylidenepentanedioic acid
(2S)-2-amino-5-(ethylamino)-5-oxopentanoic acid;(2S)-2-amino-4-methylidenepentanedioic acid (PubChem CID 22876886) has the molecular formula C13H23N3O7
and a molecular weight of 333.34 g/mol. Its IUPAC name is (2S)-2-amino-5-(ethylamino)-5-oxopentanoic acid;(2S)-2-amino-4-methylidenepentanedioic acid.
Molecular Properties
| Compound Name | (2S)-2-amino-5-(ethylamino)-5-oxopentanoic acid;(2S)-2-amino-4-methylidenepentanedioic acid |
| PubChem CID | 22876886 |
| Molecular Formula | C13H23N3O7 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | (2S)-2-amino-5-(ethylamino)-5-oxopentanoic acid;(2S)-2-amino-4-methylidenepentanedioic acid |
| SMILES | C=C(C[C@H](N)C(=O)O)C(=O)O.CCNC(=O)CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C7H14N2O3.C6H9NO4/c1-2-9-6(10)4-3-5(8)7(11)12;1-3(5(8)9)2-4(7)6(10)11/h5H,2-4,8H2,1H3,(H,9,10)(H,11,12);4H,1-2,7H2,(H,8,9)(H,10,11)/t5-;4-/m00/s1 |
| InChIKey | GLZHTNQPRJYTFF-VDQHJUMDSA-N |
| XLogP | -1.26 |
| TPSA | 193.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-amino-5-(ethylamino)-5-oxopentanoic acid;(2S)-2-amino-4-methylidenepentanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-5-(ethylamino)-5-oxopentanoic acid;(2S)-2-amino-4-methylidenepentanedioic acid?
The IUPAC name of (2S)-2-amino-5-(ethylamino)-5-oxopentanoic acid;(2S)-2-amino-4-methylidenepentanedioic acid (CID 22876886) is (2S)-2-amino-5-(ethylamino)-5-oxopentanoic acid;(2S)-2-amino-4-methylidenepentanedioic acid.
What is the SMILES notation for (2S)-2-amino-5-(ethylamino)-5-oxopentanoic acid;(2S)-2-amino-4-methylidenepentanedioic acid?
The canonical SMILES for (2S)-2-amino-5-(ethylamino)-5-oxopentanoic acid;(2S)-2-amino-4-methylidenepentanedioic acid is C=C(C[C@H](N)C(=O)O)C(=O)O.CCNC(=O)CC[C@H](N)C(=O)O.
What is the InChIKey of (2S)-2-amino-5-(ethylamino)-5-oxopentanoic acid;(2S)-2-amino-4-methylidenepentanedioic acid?
The InChIKey is GLZHTNQPRJYTFF-VDQHJUMDSA-N. The full InChI is InChI=1S/C7H14N2O3.C6H9NO4/c1-2-9-6(10)4-3-5(8)7(11)12;1-3(5(8)9)2-4(7)6(10)11/h5H,2-4,8H2,1H3,(H,9,10)(H,11,12);4H,1-2,7H2,(H,8,9)(H,10,11)/t5-;4-/m00/s1.
What are the key properties of (2S)-2-amino-5-(ethylamino)-5-oxopentanoic acid;(2S)-2-amino-4-methylidenepentanedioic acid?
(2S)-2-amino-5-(ethylamino)-5-oxopentanoic acid;(2S)-2-amino-4-methylidenepentanedioic acid has a molecular weight of 333.34 g/mol, XLogP of -1.26, 9 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-5-(ethylamino)-5-oxopentanoic acid;(2S)-2-amino-4-methylidenepentanedioic acid is sourced from PubChem (CID 22876886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).