About ethyl 2-[2-[(Z)-(2,5-dioxoimidazolidin-4-ylidene)methyl]phenoxy]acetate
ethyl 2-[2-[(Z)-(2,5-dioxoimidazolidin-4-ylidene)methyl]phenoxy]acetate (PubChem CID 2287703) has the molecular formula C14H14N2O5
and a molecular weight of 290.28 g/mol. Its IUPAC name is ethyl 2-[2-[(Z)-(2,5-dioxoimidazolidin-4-ylidene)methyl]phenoxy]acetate.
Molecular Properties
| Compound Name | ethyl 2-[2-[(Z)-(2,5-dioxoimidazolidin-4-ylidene)methyl]phenoxy]acetate |
| PubChem CID | 2287703 |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | ethyl 2-[2-[(Z)-(2,5-dioxoimidazolidin-4-ylidene)methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccccc1/C=C1\NC(=O)NC1=O |
| InChI | InChI=1S/C14H14N2O5/c1-2-20-12(17)8-21-11-6-4-3-5-9(11)7-10-13(18)16-14(19)15-10/h3-7H,2,8H2,1H3,(H2,15,16,18,19)/b10-7- |
| InChIKey | AZRWWSXGFMNHEO-YFHOEESVSA-N |
| XLogP | 0.81 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[2-[(Z)-(2,5-dioxoimidazolidin-4-ylidene)methyl]phenoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[2-[(Z)-(2,5-dioxoimidazolidin-4-ylidene)methyl]phenoxy]acetate?
The IUPAC name of ethyl 2-[2-[(Z)-(2,5-dioxoimidazolidin-4-ylidene)methyl]phenoxy]acetate (CID 2287703) is ethyl 2-[2-[(Z)-(2,5-dioxoimidazolidin-4-ylidene)methyl]phenoxy]acetate.
What is the SMILES notation for ethyl 2-[2-[(Z)-(2,5-dioxoimidazolidin-4-ylidene)methyl]phenoxy]acetate?
The canonical SMILES for ethyl 2-[2-[(Z)-(2,5-dioxoimidazolidin-4-ylidene)methyl]phenoxy]acetate is CCOC(=O)COc1ccccc1/C=C1\NC(=O)NC1=O.
What is the InChIKey of ethyl 2-[2-[(Z)-(2,5-dioxoimidazolidin-4-ylidene)methyl]phenoxy]acetate?
The InChIKey is AZRWWSXGFMNHEO-YFHOEESVSA-N. The full InChI is InChI=1S/C14H14N2O5/c1-2-20-12(17)8-21-11-6-4-3-5-9(11)7-10-13(18)16-14(19)15-10/h3-7H,2,8H2,1H3,(H2,15,16,18,19)/b10-7-.
What are the key properties of ethyl 2-[2-[(Z)-(2,5-dioxoimidazolidin-4-ylidene)methyl]phenoxy]acetate?
ethyl 2-[2-[(Z)-(2,5-dioxoimidazolidin-4-ylidene)methyl]phenoxy]acetate has a molecular weight of 290.28 g/mol, XLogP of 0.81, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[2-[(Z)-(2,5-dioxoimidazolidin-4-ylidene)methyl]phenoxy]acetate is sourced from PubChem (CID 2287703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).