C12H18N4O4S — CID 22877127
N-(diaminomethylidene)-4-[[(2R)-2-hydroxypropyl]amino]-3-methylsulfonylbenzamide (PubChem CID 22877127) has the molecular formula C12H18N4O4S and a molecular weight of 314.37 g/mol. Its IUPAC name is N-(diaminomethylidene)-4-[[(2R)-2-hydroxypropyl]amino]-3-methylsulfonylbenzamide.
| Compound Name | N-(diaminomethylidene)-4-[[(2R)-2-hydroxypropyl]amino]-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 22877127 |
| Molecular Formula | C12H18N4O4S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | N-(diaminomethylidene)-4-[[(2R)-2-hydroxypropyl]amino]-3-methylsulfonylbenzamide |
| SMILES | C[C@@H](O)CNc1ccc(C(=O)N=C(N)N)cc1S(C)(=O)=O |
| InChI | InChI=1S/C12H18N4O4S/c1-7(17)6-15-9-4-3-8(11(18)16-12(13)14)5-10(9)21(2,19)20/h3-5,7,15,17H,6H2,1-2H3,(H4,13,14,16,18)/t7-/m1/s1 |
| InChIKey | UWEGLXMURXPDHM-SSDOTTSWSA-N |
| XLogP | -0.70 |
| TPSA | 147.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|