C29H40N4O3S — CID 22877919
N-[(7R)-3-hydroxy-7-[6-[2-(2-oxo-3H-1,3-benzothiazol-6-yl)ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]formamide (PubChem CID 22877919) has the molecular formula C29H40N4O3S and a molecular weight of 524.73 g/mol. Its IUPAC name is N-[(7R)-3-hydroxy-7-[6-[2-(2-oxo-3H-1,3-benzothiazol-6-yl)ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]formamide.
| Compound Name | N-[(7R)-3-hydroxy-7-[6-[2-(2-oxo-3H-1,3-benzothiazol-6-yl)ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]formamide |
|---|---|
| PubChem CID | 22877919 |
| Molecular Formula | C29H40N4O3S |
| Molecular Weight | 524.73 g/mol |
| Exact Mass | 524.28 |
| IUPAC Name | N-[(7R)-3-hydroxy-7-[6-[2-(2-oxo-3H-1,3-benzothiazol-6-yl)ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]formamide |
| SMILES | CCCN(CCCCCCNCCc1ccc2[nH]c(=O)sc2c1)[C@@H]1CCc2cc(O)c(NC=O)cc2C1 |
| InChI | InChI=1S/C29H40N4O3S/c1-2-14-33(24-9-8-22-19-27(35)26(31-20-34)18-23(22)17-24)15-6-4-3-5-12-30-13-11-21-7-10-25-28(16-21)37-29(36)32-25/h7,10,16,18-20,24,30,35H,2-6,8-9,11-15,17H2,1H3,(H,31,34)(H,32,36)/t24-/m1/s1 |
| InChIKey | JXQVWIOYUGCIKZ-XMMPIXPASA-N |
| XLogP | 4.83 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.73 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|