C28H40N4O3 — CID 22877929
5-[2-[6-[[(2S)-5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]hexylamino]ethyl]-1,2-dihydroindazol-3-one (PubChem CID 22877929) has the molecular formula C28H40N4O3 and a molecular weight of 480.65 g/mol. Its IUPAC name is 5-[2-[6-[[(2S)-5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]hexylamino]ethyl]-1,2-dihydroindazol-3-one.
| Compound Name | 5-[2-[6-[[(2S)-5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]hexylamino]ethyl]-1,2-dihydroindazol-3-one |
|---|---|
| PubChem CID | 22877929 |
| Molecular Formula | C28H40N4O3 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.31 |
| IUPAC Name | 5-[2-[6-[[(2S)-5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]hexylamino]ethyl]-1,2-dihydroindazol-3-one |
| SMILES | CCCN(CCCCCCNCCc1ccc2[nH][nH]c(=O)c2c1)[C@H]1CCc2c(ccc(O)c2O)C1 |
| InChI | InChI=1S/C28H40N4O3/c1-2-16-32(22-9-10-23-21(19-22)8-12-26(33)27(23)34)17-6-4-3-5-14-29-15-13-20-7-11-25-24(18-20)28(35)31-30-25/h7-8,11-12,18,22,29,33-34H,2-6,9-10,13-17,19H2,1H3,(H2,30,31,35)/t22-/m0/s1 |
| InChIKey | SDLFGYSFRWDTDV-QFIPXVFZSA-N |
| XLogP | 4.23 |
| TPSA | 104.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|