C28H42N2O3 — CID 22877944
(6S)-6-[6-[2-(4-hydroxy-3-methylphenyl)ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol (PubChem CID 22877944) has the molecular formula C28H42N2O3 and a molecular weight of 454.66 g/mol. Its IUPAC name is (6S)-6-[6-[2-(4-hydroxy-3-methylphenyl)ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol.
| Compound Name | (6S)-6-[6-[2-(4-hydroxy-3-methylphenyl)ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol |
|---|---|
| PubChem CID | 22877944 |
| Molecular Formula | C28H42N2O3 |
| Molecular Weight | 454.66 g/mol |
| Exact Mass | 454.32 |
| IUPAC Name | (6S)-6-[6-[2-(4-hydroxy-3-methylphenyl)ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol |
| SMILES | CCCN(CCCCCCNCCc1ccc(O)c(C)c1)[C@H]1CCc2c(ccc(O)c2O)C1 |
| InChI | InChI=1S/C28H42N2O3/c1-3-17-30(24-10-11-25-23(20-24)9-13-27(32)28(25)33)18-7-5-4-6-15-29-16-14-22-8-12-26(31)21(2)19-22/h8-9,12-13,19,24,29,31-33H,3-7,10-11,14-18,20H2,1-2H3/t24-/m0/s1 |
| InChIKey | HHLGOVICOMTSPS-DEOSSOPVSA-N |
| XLogP | 5.07 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.66 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|