C13H17NO3 — CID 22878261
cis-(1R,2S)-2-[(4-nitrophenyl)methyl]cyclohexan-1-ol (PubChem CID 22878261) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is cis-(1R,2S)-2-[(4-nitrophenyl)methyl]cyclohexan-1-ol.
| Compound Name | cis-(1R,2S)-2-[(4-nitrophenyl)methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 22878261 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | cis-(1R,2S)-2-[(4-nitrophenyl)methyl]cyclohexan-1-ol |
| SMILES | O=[N+]([O-])c1ccc(C[C@@H]2CCCC[C@H]2O)cc1 |
| InChI | InChI=1S/C13H17NO3/c15-13-4-2-1-3-11(13)9-10-5-7-12(8-6-10)14(16)17/h5-8,11,13,15H,1-4,9H2/t11-,13+/m0/s1 |
| InChIKey | IUFQHOPFXRTVQZ-WCQYABFASA-N |
| XLogP | 2.69 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|