C9H12O8 — CID 22878497
(3S)-3-hydroxy-3-[(1S,2R,3R)-1,2,3,4-tetrahydroxybutyl]cyclopentane-1,2,4-trione (PubChem CID 22878497) has the molecular formula C9H12O8 and a molecular weight of 248.19 g/mol. Its IUPAC name is (3S)-3-hydroxy-3-[(1S,2R,3R)-1,2,3,4-tetrahydroxybutyl]cyclopentane-1,2,4-trione.
| Compound Name | (3S)-3-hydroxy-3-[(1S,2R,3R)-1,2,3,4-tetrahydroxybutyl]cyclopentane-1,2,4-trione |
|---|---|
| PubChem CID | 22878497 |
| Molecular Formula | C9H12O8 |
| Molecular Weight | 248.19 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | (3S)-3-hydroxy-3-[(1S,2R,3R)-1,2,3,4-tetrahydroxybutyl]cyclopentane-1,2,4-trione |
| SMILES | O=C1CC(=O)[C@@](O)([C@@H](O)[C@H](O)[C@H](O)CO)C1=O |
| InChI | InChI=1S/C9H12O8/c10-2-4(12)6(14)8(16)9(17)5(13)1-3(11)7(9)15/h4,6,8,10,12,14,16-17H,1-2H2/t4-,6-,8+,9+/m1/s1 |
| InChIKey | ZWTLPAHBOKNNQS-VFGPBYPCSA-N |
| XLogP | -4.10 |
| TPSA | 152.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.19 |
| LogP ≤ 5 | -4.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|