C22H32ClN5O3 — CID 22878605
propan-2-yl 3-[4-[1-(4-carbamimidoylphenyl)-3-methyl-5-oxo-1,2,4-triazol-4-yl]cyclohexyl]propanoate;hydrochloride (PubChem CID 22878605) has the molecular formula C22H32ClN5O3 and a molecular weight of 449.98 g/mol. Its IUPAC name is propan-2-yl 3-[4-[1-(4-carbamimidoylphenyl)-3-methyl-5-oxo-1,2,4-triazol-4-yl]cyclohexyl]propanoate;hydrochloride.
| Compound Name | propan-2-yl 3-[4-[1-(4-carbamimidoylphenyl)-3-methyl-5-oxo-1,2,4-triazol-4-yl]cyclohexyl]propanoate;hydrochloride |
|---|---|
| PubChem CID | 22878605 |
| Molecular Formula | C22H32ClN5O3 |
| Molecular Weight | 449.98 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | propan-2-yl 3-[4-[1-(4-carbamimidoylphenyl)-3-methyl-5-oxo-1,2,4-triazol-4-yl]cyclohexyl]propanoate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(-n2nc(C)n(C3CCC(CCC(=O)OC(C)C)CC3)c2=O)cc1 |
| InChI | InChI=1S/C22H31N5O3.ClH/c1-14(2)30-20(28)13-6-16-4-9-18(10-5-16)26-15(3)25-27(22(26)29)19-11-7-17(8-12-19)21(23)24;/h7-8,11-12,14,16,18H,4-6,9-10,13H2,1-3H3,(H3,23,24);1H |
| InChIKey | FIKBGHADCXPXQF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 115.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.98 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|