C21H29N3O — CID 22879211
(2S,3S)-N-[[5-(dimethylamino)-2-methoxyphenyl]methyl]-2-phenylpiperidin-3-amine (PubChem CID 22879211) has the molecular formula C21H29N3O and a molecular weight of 339.48 g/mol. Its IUPAC name is (2S,3S)-N-[[5-(dimethylamino)-2-methoxyphenyl]methyl]-2-phenylpiperidin-3-amine.
| Compound Name | (2S,3S)-N-[[5-(dimethylamino)-2-methoxyphenyl]methyl]-2-phenylpiperidin-3-amine |
|---|---|
| PubChem CID | 22879211 |
| Molecular Formula | C21H29N3O |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | (2S,3S)-N-[[5-(dimethylamino)-2-methoxyphenyl]methyl]-2-phenylpiperidin-3-amine |
| SMILES | COc1ccc(N(C)C)cc1CN[C@H]1CCCN[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H29N3O/c1-24(2)18-11-12-20(25-3)17(14-18)15-23-19-10-7-13-22-21(19)16-8-5-4-6-9-16/h4-6,8-9,11-12,14,19,21-23H,7,10,13,15H2,1-3H3/t19-,21-/m0/s1 |
| InChIKey | BGXQNEJEOAGRKU-FPOVZHCZSA-N |
| XLogP | 3.34 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|