About (3S)-3-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]-4-oxobutanoic acid
(3S)-3-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]-4-oxobutanoic acid (PubChem CID 22880017) has the molecular formula C14H21NO6S
and a molecular weight of 331.39 g/mol. Its IUPAC name is (3S)-3-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]-4-oxobutanoic acid.
Molecular Properties
| Compound Name | (3S)-3-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]-4-oxobutanoic acid |
| PubChem CID | 22880017 |
| Molecular Formula | C14H21NO6S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | (3S)-3-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]-4-oxobutanoic acid |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)N[C@H](C=O)CC(=O)O)C(=O)C2 |
| InChI | InChI=1S/C14H21NO6S/c1-13(2)9-3-4-14(13,11(17)5-9)8-22(20,21)15-10(7-16)6-12(18)19/h7,9-10,15H,3-6,8H2,1-2H3,(H,18,19)/t9?,10-,14?/m0/s1 |
| InChIKey | NHKSXHRXNUGNBJ-XIRUVYRFSA-N |
| XLogP | 0.34 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]-4-oxobutanoic acid?
The IUPAC name of (3S)-3-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]-4-oxobutanoic acid (CID 22880017) is (3S)-3-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]-4-oxobutanoic acid.
What is the SMILES notation for (3S)-3-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]-4-oxobutanoic acid?
The canonical SMILES for (3S)-3-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]-4-oxobutanoic acid is CC1(C)C2CCC1(CS(=O)(=O)N[C@H](C=O)CC(=O)O)C(=O)C2.
What is the InChIKey of (3S)-3-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]-4-oxobutanoic acid?
The InChIKey is NHKSXHRXNUGNBJ-XIRUVYRFSA-N. The full InChI is InChI=1S/C14H21NO6S/c1-13(2)9-3-4-14(13,11(17)5-9)8-22(20,21)15-10(7-16)6-12(18)19/h7,9-10,15H,3-6,8H2,1-2H3,(H,18,19)/t9?,10-,14?/m0/s1.
What are the key properties of (3S)-3-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]-4-oxobutanoic acid?
(3S)-3-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]-4-oxobutanoic acid has a molecular weight of 331.39 g/mol, XLogP of 0.34, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]-4-oxobutanoic acid is sourced from PubChem (CID 22880017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).