C13H21F3O3 — CID 22880099
(2S,3S,6R)-6-hexoxy-2-(2,2,2-trifluoroethyl)-3,6-dihydro-2H-pyran-3-ol (PubChem CID 22880099) has the molecular formula C13H21F3O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is (2S,3S,6R)-6-hexoxy-2-(2,2,2-trifluoroethyl)-3,6-dihydro-2H-pyran-3-ol.
| Compound Name | (2S,3S,6R)-6-hexoxy-2-(2,2,2-trifluoroethyl)-3,6-dihydro-2H-pyran-3-ol |
|---|---|
| PubChem CID | 22880099 |
| Molecular Formula | C13H21F3O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | (2S,3S,6R)-6-hexoxy-2-(2,2,2-trifluoroethyl)-3,6-dihydro-2H-pyran-3-ol |
| SMILES | CCCCCCO[C@H]1C=C[C@H](O)[C@H](CC(F)(F)F)O1 |
| InChI | InChI=1S/C13H21F3O3/c1-2-3-4-5-8-18-12-7-6-10(17)11(19-12)9-13(14,15)16/h6-7,10-12,17H,2-5,8-9H2,1H3/t10-,11-,12+/m0/s1 |
| InChIKey | FZBPXTPPGCKXAH-SDDRHHMPSA-N |
| XLogP | 3.18 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|