C12H21F3O3Si — CID 22880106
(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(trifluoromethyl)-3,6-dihydro-2H-pyran-6-ol (PubChem CID 22880106) has the molecular formula C12H21F3O3Si and a molecular weight of 298.38 g/mol. Its IUPAC name is (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(trifluoromethyl)-3,6-dihydro-2H-pyran-6-ol.
| Compound Name | (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(trifluoromethyl)-3,6-dihydro-2H-pyran-6-ol |
|---|---|
| PubChem CID | 22880106 |
| Molecular Formula | C12H21F3O3Si |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(trifluoromethyl)-3,6-dihydro-2H-pyran-6-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C=CC(O)O[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C12H21F3O3Si/c1-11(2,3)19(4,5)18-8-6-7-9(16)17-10(8)12(13,14)15/h6-10,16H,1-5H3/t8-,9?,10-/m0/s1 |
| InChIKey | IUUADCOWJZPHKS-SMILAEQMSA-N |
| XLogP | 3.21 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|