C28H34N8O6 — CID 22881358
3-[[(2S)-2-[[(2S)-3-methyl-2-(3-phenylpropanoylamino)butanoyl]amino]propanoyl]amino]-4-oxo-5-(5-pyridin-3-yltetrazol-2-yl)pentanoic acid (PubChem CID 22881358) has the molecular formula C28H34N8O6 and a molecular weight of 578.63 g/mol. Its IUPAC name is 3-[[(2S)-2-[[(2S)-3-methyl-2-(3-phenylpropanoylamino)butanoyl]amino]propanoyl]amino]-4-oxo-5-(5-pyridin-3-yltetrazol-2-yl)pentanoic acid.
| Compound Name | 3-[[(2S)-2-[[(2S)-3-methyl-2-(3-phenylpropanoylamino)butanoyl]amino]propanoyl]amino]-4-oxo-5-(5-pyridin-3-yltetrazol-2-yl)pentanoic acid |
|---|---|
| PubChem CID | 22881358 |
| Molecular Formula | C28H34N8O6 |
| Molecular Weight | 578.63 g/mol |
| Exact Mass | 578.26 |
| IUPAC Name | 3-[[(2S)-2-[[(2S)-3-methyl-2-(3-phenylpropanoylamino)butanoyl]amino]propanoyl]amino]-4-oxo-5-(5-pyridin-3-yltetrazol-2-yl)pentanoic acid |
| SMILES | CC(C)[C@H](NC(=O)CCc1ccccc1)C(=O)N[C@@H](C)C(=O)NC(CC(=O)O)C(=O)Cn1nnc(-c2cccnc2)n1 |
| InChI | InChI=1S/C28H34N8O6/c1-17(2)25(32-23(38)12-11-19-8-5-4-6-9-19)28(42)30-18(3)27(41)31-21(14-24(39)40)22(37)16-36-34-26(33-35-36)20-10-7-13-29-15-20/h4-10,13,15,17-18,21,25H,11-12,14,16H2,1-3H3,(H,30,42)(H,31,41)(H,32,38)(H,39,40)/t18-,21?,25-/m0/s1 |
| InChIKey | YAKZQXMCXVTBFU-FGSAWCKXSA-N |
| XLogP | 0.54 |
| TPSA | 198.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.63 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |