C22H32N2O6S — CID 22882265
(2R,4S,5S)-5-amino-4-hydroxy-9-[(2R)-2-methoxycarbonyl-2,3-dihydro-1,4-benzothiazin-4-yl]-2,7,7-trimethyl-9-oxononanoic acid (PubChem CID 22882265) has the molecular formula C22H32N2O6S and a molecular weight of 452.57 g/mol. Its IUPAC name is (2R,4S,5S)-5-amino-4-hydroxy-9-[(2R)-2-methoxycarbonyl-2,3-dihydro-1,4-benzothiazin-4-yl]-2,7,7-trimethyl-9-oxononanoic acid.
| Compound Name | (2R,4S,5S)-5-amino-4-hydroxy-9-[(2R)-2-methoxycarbonyl-2,3-dihydro-1,4-benzothiazin-4-yl]-2,7,7-trimethyl-9-oxononanoic acid |
|---|---|
| PubChem CID | 22882265 |
| Molecular Formula | C22H32N2O6S |
| Molecular Weight | 452.57 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | (2R,4S,5S)-5-amino-4-hydroxy-9-[(2R)-2-methoxycarbonyl-2,3-dihydro-1,4-benzothiazin-4-yl]-2,7,7-trimethyl-9-oxononanoic acid |
| SMILES | COC(=O)[C@H]1CN(C(=O)CC(C)(C)C[C@H](N)[C@@H](O)C[C@@H](C)C(=O)O)c2ccccc2S1 |
| InChI | InChI=1S/C22H32N2O6S/c1-13(20(27)28)9-16(25)14(23)10-22(2,3)11-19(26)24-12-18(21(29)30-4)31-17-8-6-5-7-15(17)24/h5-8,13-14,16,18,25H,9-12,23H2,1-4H3,(H,27,28)/t13-,14+,16+,18-/m1/s1 |
| InChIKey | JGGQWTLZBGOGFE-YQYZPQCESA-N |
| XLogP | 2.27 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.57 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |