C23H34N2O6 — CID 22882296
(2R,4S,5S)-5-amino-4-hydroxy-9-[(3R)-3-methoxycarbonyl-3,4-dihydro-2H-quinolin-1-yl]-2,7,7-trimethyl-9-oxononanoic acid (PubChem CID 22882296) has the molecular formula C23H34N2O6 and a molecular weight of 434.53 g/mol. Its IUPAC name is (2R,4S,5S)-5-amino-4-hydroxy-9-[(3R)-3-methoxycarbonyl-3,4-dihydro-2H-quinolin-1-yl]-2,7,7-trimethyl-9-oxononanoic acid.
| Compound Name | (2R,4S,5S)-5-amino-4-hydroxy-9-[(3R)-3-methoxycarbonyl-3,4-dihydro-2H-quinolin-1-yl]-2,7,7-trimethyl-9-oxononanoic acid |
|---|---|
| PubChem CID | 22882296 |
| Molecular Formula | C23H34N2O6 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | (2R,4S,5S)-5-amino-4-hydroxy-9-[(3R)-3-methoxycarbonyl-3,4-dihydro-2H-quinolin-1-yl]-2,7,7-trimethyl-9-oxononanoic acid |
| SMILES | COC(=O)[C@@H]1Cc2ccccc2N(C(=O)CC(C)(C)C[C@H](N)[C@@H](O)C[C@@H](C)C(=O)O)C1 |
| InChI | InChI=1S/C23H34N2O6/c1-14(21(28)29)9-19(26)17(24)11-23(2,3)12-20(27)25-13-16(22(30)31-4)10-15-7-5-6-8-18(15)25/h5-8,14,16-17,19,26H,9-13,24H2,1-4H3,(H,28,29)/t14-,16-,17+,19+/m1/s1 |
| InChIKey | DBYIWMAMVQYBII-NWGLXNPWSA-N |
| XLogP | 1.97 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |