About 1-[(3R)-1-benzyl-3,4-dihydro-2H-quinolin-3-yl]ethanone
1-[(3R)-1-benzyl-3,4-dihydro-2H-quinolin-3-yl]ethanone (PubChem CID 22882347) has the molecular formula C18H19NO
and a molecular weight of 265.36 g/mol. Its IUPAC name is 1-[(3R)-1-benzyl-3,4-dihydro-2H-quinolin-3-yl]ethanone.
Molecular Properties
| Compound Name | 1-[(3R)-1-benzyl-3,4-dihydro-2H-quinolin-3-yl]ethanone |
| PubChem CID | 22882347 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 1-[(3R)-1-benzyl-3,4-dihydro-2H-quinolin-3-yl]ethanone |
| SMILES | CC(=O)[C@@H]1Cc2ccccc2N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C18H19NO/c1-14(20)17-11-16-9-5-6-10-18(16)19(13-17)12-15-7-3-2-4-8-15/h2-10,17H,11-13H2,1H3/t17-/m1/s1 |
| InChIKey | VLUSRWBBWKRYEW-QGZVFWFLSA-N |
| XLogP | 3.45 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(3R)-1-benzyl-3,4-dihydro-2H-quinolin-3-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3R)-1-benzyl-3,4-dihydro-2H-quinolin-3-yl]ethanone?
The IUPAC name of 1-[(3R)-1-benzyl-3,4-dihydro-2H-quinolin-3-yl]ethanone (CID 22882347) is 1-[(3R)-1-benzyl-3,4-dihydro-2H-quinolin-3-yl]ethanone.
What is the SMILES notation for 1-[(3R)-1-benzyl-3,4-dihydro-2H-quinolin-3-yl]ethanone?
The canonical SMILES for 1-[(3R)-1-benzyl-3,4-dihydro-2H-quinolin-3-yl]ethanone is CC(=O)[C@@H]1Cc2ccccc2N(Cc2ccccc2)C1.
What is the InChIKey of 1-[(3R)-1-benzyl-3,4-dihydro-2H-quinolin-3-yl]ethanone?
The InChIKey is VLUSRWBBWKRYEW-QGZVFWFLSA-N. The full InChI is InChI=1S/C18H19NO/c1-14(20)17-11-16-9-5-6-10-18(16)19(13-17)12-15-7-3-2-4-8-15/h2-10,17H,11-13H2,1H3/t17-/m1/s1.
What are the key properties of 1-[(3R)-1-benzyl-3,4-dihydro-2H-quinolin-3-yl]ethanone?
1-[(3R)-1-benzyl-3,4-dihydro-2H-quinolin-3-yl]ethanone has a molecular weight of 265.36 g/mol, XLogP of 3.45, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3R)-1-benzyl-3,4-dihydro-2H-quinolin-3-yl]ethanone is sourced from PubChem (CID 22882347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).