C29H57NO4Si — CID 22882487
tert-butyl (4S,5S)-5-but-3-enyl-4-[2,2-dimethyl-4-tri(propan-2-yl)silyloxybutyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 22882487) has the molecular formula C29H57NO4Si and a molecular weight of 511.86 g/mol. Its IUPAC name is tert-butyl (4S,5S)-5-but-3-enyl-4-[2,2-dimethyl-4-tri(propan-2-yl)silyloxybutyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S,5S)-5-but-3-enyl-4-[2,2-dimethyl-4-tri(propan-2-yl)silyloxybutyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 22882487 |
| Molecular Formula | C29H57NO4Si |
| Molecular Weight | 511.86 g/mol |
| Exact Mass | 511.41 |
| IUPAC Name | tert-butyl (4S,5S)-5-but-3-enyl-4-[2,2-dimethyl-4-tri(propan-2-yl)silyloxybutyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C=CCC[C@@H]1OC(C)(C)N(C(=O)OC(C)(C)C)[C@H]1CC(C)(C)CCO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C29H57NO4Si/c1-15-16-17-25-24(30(29(13,14)33-25)26(31)34-27(8,9)10)20-28(11,12)18-19-32-35(21(2)3,22(4)5)23(6)7/h15,21-25H,1,16-20H2,2-14H3/t24-,25-/m0/s1 |
| InChIKey | NAQHUTORYQRUDB-DQEYMECFSA-N |
| XLogP | 8.69 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.86 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|