C50H36N4O8 — CID 22882667
1-[4-[[1,6,6-tris[[4-(2,5-dioxopyrrol-1-yl)phenyl]methyl]cyclohexa-2,4-dien-1-yl]methyl]phenyl]pyrrole-2,5-dione (PubChem CID 22882667) has the molecular formula C50H36N4O8 and a molecular weight of 820.86 g/mol. Its IUPAC name is 1-[4-[[1,6,6-tris[[4-(2,5-dioxopyrrol-1-yl)phenyl]methyl]cyclohexa-2,4-dien-1-yl]methyl]phenyl]pyrrole-2,5-dione.
| Compound Name | 1-[4-[[1,6,6-tris[[4-(2,5-dioxopyrrol-1-yl)phenyl]methyl]cyclohexa-2,4-dien-1-yl]methyl]phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 22882667 |
| Molecular Formula | C50H36N4O8 |
| Molecular Weight | 820.86 g/mol |
| Exact Mass | 820.25 |
| IUPAC Name | 1-[4-[[1,6,6-tris[[4-(2,5-dioxopyrrol-1-yl)phenyl]methyl]cyclohexa-2,4-dien-1-yl]methyl]phenyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1c1ccc(CC2(Cc3ccc(N4C(=O)C=CC4=O)cc3)C=CC=CC2(Cc2ccc(N3C(=O)C=CC3=O)cc2)Cc2ccc(N3C(=O)C=CC3=O)cc2)cc1 |
| InChI | InChI=1S/C50H36N4O8/c55-41-19-20-42(56)51(41)37-11-3-33(4-12-37)29-49(30-34-5-13-38(14-6-34)52-43(57)21-22-44(52)58)27-1-2-28-50(49,31-35-7-15-39(16-8-35)53-45(59)23-24-46(53)60)32-36-9-17-40(18-10-36)54-47(61)25-26-48(54)62/h1-28H,29-32H2 |
| InChIKey | OYJPGIVFALWPNL-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 149.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.86 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|